C21H24Cl2N2O2 — CID 100647671
(2R)-2-[benzyl-[2-(2,6-dichlorophenyl)acetyl]amino]-N-propan-2-ylpropanamide (PubChem CID 100647671) has the molecular formula C21H24Cl2N2O2 and a molecular weight of 407.34 g/mol. Its IUPAC name is (2R)-2-[benzyl-[2-(2,6-dichlorophenyl)acetyl]amino]-N-propan-2-ylpropanamide.
| Compound Name | (2R)-2-[benzyl-[2-(2,6-dichlorophenyl)acetyl]amino]-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 100647671 |
| Molecular Formula | C21H24Cl2N2O2 |
| Molecular Weight | 407.34 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | (2R)-2-[benzyl-[2-(2,6-dichlorophenyl)acetyl]amino]-N-propan-2-ylpropanamide |
| SMILES | CC(C)NC(=O)[C@@H](C)N(Cc1ccccc1)C(=O)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C21H24Cl2N2O2/c1-14(2)24-21(27)15(3)25(13-16-8-5-4-6-9-16)20(26)12-17-18(22)10-7-11-19(17)23/h4-11,14-15H,12-13H2,1-3H3,(H,24,27)/t15-/m1/s1 |
| InChIKey | CCHYZJZNYJWOHQ-OAHLLOKOSA-N |
| XLogP | 4.48 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.34 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |