C24H16N4O3 — CID 1006484
2-[5-[(E)-(2-amino-3,7-dicyano-4,6-dimethylcyclopenta[b]pyridin-5-ylidene)methyl]furan-2-yl]benzoic acid (PubChem CID 1006484) has the molecular formula C24H16N4O3 and a molecular weight of 408.42 g/mol. Its IUPAC name is 2-[5-[(E)-(2-amino-3,7-dicyano-4,6-dimethylcyclopenta[b]pyridin-5-ylidene)methyl]furan-2-yl]benzoic acid.
| Compound Name | 2-[5-[(E)-(2-amino-3,7-dicyano-4,6-dimethylcyclopenta[b]pyridin-5-ylidene)methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 1006484 |
| Molecular Formula | C24H16N4O3 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | 2-[5-[(E)-(2-amino-3,7-dicyano-4,6-dimethylcyclopenta[b]pyridin-5-ylidene)methyl]furan-2-yl]benzoic acid |
| SMILES | CC1=C(C#N)c2nc(N)c(C#N)c(C)c2/C1=C/c1ccc(-c2ccccc2C(=O)O)o1 |
| InChI | InChI=1S/C24H16N4O3/c1-12-17(21-13(2)19(11-26)23(27)28-22(21)18(12)10-25)9-14-7-8-20(31-14)15-5-3-4-6-16(15)24(29)30/h3-9H,1-2H3,(H2,27,28)(H,29,30)/b17-9+ |
| InChIKey | YAMTZUZWURNHAX-RQZCQDPDSA-N |
| XLogP | 4.65 |
| TPSA | 136.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_B(7)', 'substructure': 'N/A'} |
|---|