C16H22N6O3 — CID 100648871
(3R)-N-(6-butoxy-3-pyridinyl)-3-(1H-1,2,4-triazol-5-yl)morpholine-4-carboxamide (PubChem CID 100648871) has the molecular formula C16H22N6O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is (3R)-N-(6-butoxy-3-pyridinyl)-3-(1H-1,2,4-triazol-5-yl)morpholine-4-carboxamide.
| Compound Name | (3R)-N-(6-butoxy-3-pyridinyl)-3-(1H-1,2,4-triazol-5-yl)morpholine-4-carboxamide |
|---|---|
| PubChem CID | 100648871 |
| Molecular Formula | C16H22N6O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | (3R)-N-(6-butoxy-3-pyridinyl)-3-(1H-1,2,4-triazol-5-yl)morpholine-4-carboxamide |
| SMILES | CCCCOc1ccc(NC(=O)N2CCOC[C@H]2c2ncn[nH]2)cn1 |
| InChI | InChI=1S/C16H22N6O3/c1-2-3-7-25-14-5-4-12(9-17-14)20-16(23)22-6-8-24-10-13(22)15-18-11-19-21-15/h4-5,9,11,13H,2-3,6-8,10H2,1H3,(H,20,23)(H,18,19,21)/t13-/m0/s1 |
| InChIKey | XTXGEJZQZHLSEX-ZDUSSCGKSA-N |
| XLogP | 1.98 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|