About cyclooctyl 4-sulfamoyloxybenzoate
cyclooctyl 4-sulfamoyloxybenzoate (PubChem CID 10065009) has the molecular formula C15H21NO5S
and a molecular weight of 327.40 g/mol. Its IUPAC name is cyclooctyl 4-sulfamoyloxybenzoate.
Molecular Properties
| Compound Name | cyclooctyl 4-sulfamoyloxybenzoate |
| PubChem CID | 10065009 |
| Molecular Formula | C15H21NO5S |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | cyclooctyl 4-sulfamoyloxybenzoate |
| SMILES | NS(=O)(=O)Oc1ccc(C(=O)OC2CCCCCCC2)cc1 |
| InChI | InChI=1S/C15H21NO5S/c16-22(18,19)21-14-10-8-12(9-11-14)15(17)20-13-6-4-2-1-3-5-7-13/h8-11,13H,1-7H2,(H2,16,18,19) |
| InChIKey | AGVIMIWKQHZOFR-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze cyclooctyl 4-sulfamoyloxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclooctyl 4-sulfamoyloxybenzoate?
The IUPAC name of cyclooctyl 4-sulfamoyloxybenzoate (CID 10065009) is cyclooctyl 4-sulfamoyloxybenzoate.
What is the SMILES notation for cyclooctyl 4-sulfamoyloxybenzoate?
The canonical SMILES for cyclooctyl 4-sulfamoyloxybenzoate is NS(=O)(=O)Oc1ccc(C(=O)OC2CCCCCCC2)cc1.
What is the InChIKey of cyclooctyl 4-sulfamoyloxybenzoate?
The InChIKey is AGVIMIWKQHZOFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO5S/c16-22(18,19)21-14-10-8-12(9-11-14)15(17)20-13-6-4-2-1-3-5-7-13/h8-11,13H,1-7H2,(H2,16,18,19).
What are the key properties of cyclooctyl 4-sulfamoyloxybenzoate?
cyclooctyl 4-sulfamoyloxybenzoate has a molecular weight of 327.40 g/mol, XLogP of 2.54, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclooctyl 4-sulfamoyloxybenzoate is sourced from PubChem (CID 10065009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).