About 5-(2-chlorophenyl)spiro[1H-indole-3,1'-cyclohexane]-2-thione
5-(2-chlorophenyl)spiro[1H-indole-3,1'-cyclohexane]-2-thione (PubChem CID 10065049) has the molecular formula C19H18ClNS
and a molecular weight of 327.88 g/mol. Its IUPAC name is 5-(2-chlorophenyl)spiro[1H-indole-3,1'-cyclohexane]-2-thione.
Molecular Properties
| Compound Name | 5-(2-chlorophenyl)spiro[1H-indole-3,1'-cyclohexane]-2-thione |
| PubChem CID | 10065049 |
| Molecular Formula | C19H18ClNS |
| Molecular Weight | 327.88 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 5-(2-chlorophenyl)spiro[1H-indole-3,1'-cyclohexane]-2-thione |
| SMILES | S=C1Nc2ccc(-c3ccccc3Cl)cc2C12CCCCC2 |
| InChI | InChI=1S/C19H18ClNS/c20-16-7-3-2-6-14(16)13-8-9-17-15(12-13)19(18(22)21-17)10-4-1-5-11-19/h2-3,6-9,12H,1,4-5,10-11H2,(H,21,22) |
| InChIKey | UVVYXIGCIQBUPD-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 327.88 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-chlorophenyl)spiro[1H-indole-3,1'-cyclohexane]-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-chlorophenyl)spiro[1H-indole-3,1'-cyclohexane]-2-thione?
The IUPAC name of 5-(2-chlorophenyl)spiro[1H-indole-3,1'-cyclohexane]-2-thione (CID 10065049) is 5-(2-chlorophenyl)spiro[1H-indole-3,1'-cyclohexane]-2-thione.
What is the SMILES notation for 5-(2-chlorophenyl)spiro[1H-indole-3,1'-cyclohexane]-2-thione?
The canonical SMILES for 5-(2-chlorophenyl)spiro[1H-indole-3,1'-cyclohexane]-2-thione is S=C1Nc2ccc(-c3ccccc3Cl)cc2C12CCCCC2.
What is the InChIKey of 5-(2-chlorophenyl)spiro[1H-indole-3,1'-cyclohexane]-2-thione?
The InChIKey is UVVYXIGCIQBUPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18ClNS/c20-16-7-3-2-6-14(16)13-8-9-17-15(12-13)19(18(22)21-17)10-4-1-5-11-19/h2-3,6-9,12H,1,4-5,10-11H2,(H,21,22).
What are the key properties of 5-(2-chlorophenyl)spiro[1H-indole-3,1'-cyclohexane]-2-thione?
5-(2-chlorophenyl)spiro[1H-indole-3,1'-cyclohexane]-2-thione has a molecular weight of 327.88 g/mol, XLogP of 5.96, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-chlorophenyl)spiro[1H-indole-3,1'-cyclohexane]-2-thione is sourced from PubChem (CID 10065049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).