C11H11F3N2O3S — CID 100651064
1-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethylcarbamoyl]cyclopropane-1-carboxylic acid (PubChem CID 100651064) has the molecular formula C11H11F3N2O3S and a molecular weight of 308.28 g/mol. Its IUPAC name is 1-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethylcarbamoyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethylcarbamoyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 100651064 |
| Molecular Formula | C11H11F3N2O3S |
| Molecular Weight | 308.28 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 1-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethylcarbamoyl]cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)C1(C(=O)NCCc2nc(C(F)(F)F)cs2)CC1 |
| InChI | InChI=1S/C11H11F3N2O3S/c12-11(13,14)6-5-20-7(16-6)1-4-15-8(17)10(2-3-10)9(18)19/h5H,1-4H2,(H,15,17)(H,18,19) |
| InChIKey | TWEUUFXIQGCSGU-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.28 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|