C28H30N6O3S2 — CID 100651463
N-[5-[(4S,5R)-5-[1-[4-(dimethylamino)phenyl]pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methoxyphenyl]methanesulfonamide (PubChem CID 100651463) has the molecular formula C28H30N6O3S2 and a molecular weight of 562.72 g/mol. Its IUPAC name is N-[5-[(4S,5R)-5-[1-[4-(dimethylamino)phenyl]pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methoxyphenyl]methanesulfonamide.
| Compound Name | N-[5-[(4S,5R)-5-[1-[4-(dimethylamino)phenyl]pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methoxyphenyl]methanesulfonamide |
|---|---|
| PubChem CID | 100651463 |
| Molecular Formula | C28H30N6O3S2 |
| Molecular Weight | 562.72 g/mol |
| Exact Mass | 562.18 |
| IUPAC Name | N-[5-[(4S,5R)-5-[1-[4-(dimethylamino)phenyl]pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methoxyphenyl]methanesulfonamide |
| SMILES | COc1ccc(N2C(=S)N[C@H](c3ccccn3)[C@@H]2c2cccn2-c2ccc(N(C)C)cc2)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C28H30N6O3S2/c1-32(2)19-10-12-20(13-11-19)33-17-7-9-24(33)27-26(22-8-5-6-16-29-22)30-28(38)34(27)21-14-15-25(37-3)23(18-21)31-39(4,35)36/h5-18,26-27,31H,1-4H3,(H,30,38)/t26-,27+/m1/s1 |
| InChIKey | XGTHSMNDUWNRMO-SXOMAYOGSA-N |
| XLogP | 4.50 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.72 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|