C19H31N5 — CID 10065177
6,6-dimethyl-1-(4-octylphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 10065177) has the molecular formula C19H31N5 and a molecular weight of 329.49 g/mol. Its IUPAC name is 6,6-dimethyl-1-(4-octylphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6,6-dimethyl-1-(4-octylphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 10065177 |
| Molecular Formula | C19H31N5 |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.26 |
| IUPAC Name | 6,6-dimethyl-1-(4-octylphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCCCCCc1ccc(N2C(N)=NC(N)=NC2(C)C)cc1 |
| InChI | InChI=1S/C19H31N5/c1-4-5-6-7-8-9-10-15-11-13-16(14-12-15)24-18(21)22-17(20)23-19(24,2)3/h11-14H,4-10H2,1-3H3,(H4,20,21,22,23) |
| InChIKey | QVCAKYMDCCPESN-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|