C14H17Cl2N3O2 — CID 10065194
(3S)-7,8-dichloro-4-(cyclopropylmethyl)-3-methyl-9-nitro-1,2,3,5-tetrahydro-1,4-benzodiazepine (PubChem CID 10065194) has the molecular formula C14H17Cl2N3O2 and a molecular weight of 330.22 g/mol. Its IUPAC name is (3S)-7,8-dichloro-4-(cyclopropylmethyl)-3-methyl-9-nitro-1,2,3,5-tetrahydro-1,4-benzodiazepine.
| Compound Name | (3S)-7,8-dichloro-4-(cyclopropylmethyl)-3-methyl-9-nitro-1,2,3,5-tetrahydro-1,4-benzodiazepine |
|---|---|
| PubChem CID | 10065194 |
| Molecular Formula | C14H17Cl2N3O2 |
| Molecular Weight | 330.22 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | (3S)-7,8-dichloro-4-(cyclopropylmethyl)-3-methyl-9-nitro-1,2,3,5-tetrahydro-1,4-benzodiazepine |
| SMILES | C[C@H]1CNc2c(cc(Cl)c(Cl)c2[N+](=O)[O-])CN1CC1CC1 |
| InChI | InChI=1S/C14H17Cl2N3O2/c1-8-5-17-13-10(7-18(8)6-9-2-3-9)4-11(15)12(16)14(13)19(20)21/h4,8-9,17H,2-3,5-7H2,1H3/t8-/m0/s1 |
| InChIKey | REOODVQRWUBPCY-QMMMGPOBSA-N |
| XLogP | 3.93 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.22 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|