C13H7F5N4O — CID 10065195
5-(1,1,2,2,2-pentafluoroethyl)-6-pyridin-4-yl-1,3-dihydroimidazo[4,5-b]pyridin-2-one (PubChem CID 10065195) has the molecular formula C13H7F5N4O and a molecular weight of 330.22 g/mol. Its IUPAC name is 5-(1,1,2,2,2-pentafluoroethyl)-6-pyridin-4-yl-1,3-dihydroimidazo[4,5-b]pyridin-2-one.
| Compound Name | 5-(1,1,2,2,2-pentafluoroethyl)-6-pyridin-4-yl-1,3-dihydroimidazo[4,5-b]pyridin-2-one |
|---|---|
| PubChem CID | 10065195 |
| Molecular Formula | C13H7F5N4O |
| Molecular Weight | 330.22 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 5-(1,1,2,2,2-pentafluoroethyl)-6-pyridin-4-yl-1,3-dihydroimidazo[4,5-b]pyridin-2-one |
| SMILES | O=c1[nH]c2cc(-c3ccncc3)c(C(F)(F)C(F)(F)F)nc2[nH]1 |
| InChI | InChI=1S/C13H7F5N4O/c14-12(15,13(16,17)18)9-7(6-1-3-19-4-2-6)5-8-10(21-9)22-11(23)20-8/h1-5H,(H2,20,21,22,23) |
| InChIKey | PESFXPODUIUSOI-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.22 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|