C29H33FN2O3 — CID 100651965
(2S)-N-butyl-2-[(2-fluorophenyl)methyl-[2-(3-methylphenoxy)acetyl]amino]-3-phenylpropanamide (PubChem CID 100651965) has the molecular formula C29H33FN2O3 and a molecular weight of 476.59 g/mol. Its IUPAC name is (2S)-N-butyl-2-[(2-fluorophenyl)methyl-[2-(3-methylphenoxy)acetyl]amino]-3-phenylpropanamide.
| Compound Name | (2S)-N-butyl-2-[(2-fluorophenyl)methyl-[2-(3-methylphenoxy)acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100651965 |
| Molecular Formula | C29H33FN2O3 |
| Molecular Weight | 476.59 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | (2S)-N-butyl-2-[(2-fluorophenyl)methyl-[2-(3-methylphenoxy)acetyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@H](Cc1ccccc1)N(Cc1ccccc1F)C(=O)COc1cccc(C)c1 |
| InChI | InChI=1S/C29H33FN2O3/c1-3-4-17-31-29(34)27(19-23-12-6-5-7-13-23)32(20-24-14-8-9-16-26(24)30)28(33)21-35-25-15-10-11-22(2)18-25/h5-16,18,27H,3-4,17,19-21H2,1-2H3,(H,31,34)/t27-/m0/s1 |
| InChIKey | DZVBGDMULSBWSK-MHZLTWQESA-N |
| XLogP | 5.07 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.59 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|