C17H23FN2Si2 — CID 10065252
1-(3-fluoro-4-pyridin-4-ylphenyl)-2,2,5,5-tetramethyl-1,2,5-azadisilolidine (PubChem CID 10065252) has the molecular formula C17H23FN2Si2 and a molecular weight of 330.56 g/mol. Its IUPAC name is 1-(3-fluoro-4-pyridin-4-ylphenyl)-2,2,5,5-tetramethyl-1,2,5-azadisilolidine.
| Compound Name | 1-(3-fluoro-4-pyridin-4-ylphenyl)-2,2,5,5-tetramethyl-1,2,5-azadisilolidine |
|---|---|
| PubChem CID | 10065252 |
| Molecular Formula | C17H23FN2Si2 |
| Molecular Weight | 330.56 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 1-(3-fluoro-4-pyridin-4-ylphenyl)-2,2,5,5-tetramethyl-1,2,5-azadisilolidine |
| SMILES | C[Si]1(C)CC[Si](C)(C)N1c1ccc(-c2ccncc2)c(F)c1 |
| InChI | InChI=1S/C17H23FN2Si2/c1-21(2)11-12-22(3,4)20(21)15-5-6-16(17(18)13-15)14-7-9-19-10-8-14/h5-10,13H,11-12H2,1-4H3 |
| InChIKey | YWYCIYJFHUHQBQ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.56 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|