C14H11F7O4S — CID 100652857
[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]methyl 2-[(3S)-1,1-dioxothiolan-3-yl]acetate (PubChem CID 100652857) has the molecular formula C14H11F7O4S and a molecular weight of 408.29 g/mol. Its IUPAC name is [2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]methyl 2-[(3S)-1,1-dioxothiolan-3-yl]acetate.
| Compound Name | [2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]methyl 2-[(3S)-1,1-dioxothiolan-3-yl]acetate |
|---|---|
| PubChem CID | 100652857 |
| Molecular Formula | C14H11F7O4S |
| Molecular Weight | 408.29 g/mol |
| Exact Mass | 408.03 |
| IUPAC Name | [2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]methyl 2-[(3S)-1,1-dioxothiolan-3-yl]acetate |
| SMILES | O=C(C[C@H]1CCS(=O)(=O)C1)OCc1c(F)c(F)c(C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C14H11F7O4S/c15-10-7(11(16)13(18)9(12(10)17)14(19,20)21)4-25-8(22)3-6-1-2-26(23,24)5-6/h6H,1-5H2/t6-/m1/s1 |
| InChIKey | KHXGAOQKUSRMLM-ZCFIWIBFSA-N |
| XLogP | 3.13 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.29 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|