C16H16N2O4S — CID 10065343
methyl (9E)-3,17-dioxo-8-thia-1,4-diazatricyclo[8.7.0.011,16]heptadeca-9,11,13,15-tetraene-5-carboxylate (PubChem CID 10065343) has the molecular formula C16H16N2O4S and a molecular weight of 332.38 g/mol. Its IUPAC name is methyl (9E)-3,17-dioxo-8-thia-1,4-diazatricyclo[8.7.0.011,16]heptadeca-9,11,13,15-tetraene-5-carboxylate.
| Compound Name | methyl (9E)-3,17-dioxo-8-thia-1,4-diazatricyclo[8.7.0.011,16]heptadeca-9,11,13,15-tetraene-5-carboxylate |
|---|---|
| PubChem CID | 10065343 |
| Molecular Formula | C16H16N2O4S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | methyl (9E)-3,17-dioxo-8-thia-1,4-diazatricyclo[8.7.0.011,16]heptadeca-9,11,13,15-tetraene-5-carboxylate |
| SMILES | COC(=O)C1CCS/C=C2\c3ccccc3C(=O)N2CC(=O)N1 |
| InChI | InChI=1S/C16H16N2O4S/c1-22-16(21)12-6-7-23-9-13-10-4-2-3-5-11(10)15(20)18(13)8-14(19)17-12/h2-5,9,12H,6-8H2,1H3,(H,17,19)/b13-9+ |
| InChIKey | LNWNDEUWODWRAC-UKTHLTGXSA-N |
| XLogP | 1.24 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |