C18H17FO3S — CID 10065347
ethyl 2-(4-fluorophenyl)sulfanyl-4-oxo-4-phenylbutanoate (PubChem CID 10065347) has the molecular formula C18H17FO3S and a molecular weight of 332.40 g/mol. Its IUPAC name is ethyl 2-(4-fluorophenyl)sulfanyl-4-oxo-4-phenylbutanoate.
| Compound Name | ethyl 2-(4-fluorophenyl)sulfanyl-4-oxo-4-phenylbutanoate |
|---|---|
| PubChem CID | 10065347 |
| Molecular Formula | C18H17FO3S |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | ethyl 2-(4-fluorophenyl)sulfanyl-4-oxo-4-phenylbutanoate |
| SMILES | CCOC(=O)C(CC(=O)c1ccccc1)Sc1ccc(F)cc1 |
| InChI | InChI=1S/C18H17FO3S/c1-2-22-18(21)17(23-15-10-8-14(19)9-11-15)12-16(20)13-6-4-3-5-7-13/h3-11,17H,2,12H2,1H3 |
| InChIKey | GCNNFUWBGREHKC-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |