C20H16N2OS — CID 10065351
12-(4-methoxyphenyl)-14-thia-11,16-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,12,15-hexaene (PubChem CID 10065351) has the molecular formula C20H16N2OS and a molecular weight of 332.43 g/mol. Its IUPAC name is 12-(4-methoxyphenyl)-14-thia-11,16-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,12,15-hexaene.
| Compound Name | 12-(4-methoxyphenyl)-14-thia-11,16-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,12,15-hexaene |
|---|---|
| PubChem CID | 10065351 |
| Molecular Formula | C20H16N2OS |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 12-(4-methoxyphenyl)-14-thia-11,16-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,12,15-hexaene |
| SMILES | COc1ccc(-c2csc3nc4c(n23)CCc2ccccc2-4)cc1 |
| InChI | InChI=1S/C20H16N2OS/c1-23-15-9-6-14(7-10-15)18-12-24-20-21-19-16-5-3-2-4-13(16)8-11-17(19)22(18)20/h2-7,9-10,12H,8,11H2,1H3 |
| InChIKey | DLNIFEXSNXZFRA-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |