C22H26N4O — CID 100654194
[(2S)-1,9-dimethyl-5-(quinolin-3-ylmethyl)-2,3,4,6-tetrahydropyrido[2,3-b][1,5]diazocin-2-yl]methanol (PubChem CID 100654194) has the molecular formula C22H26N4O and a molecular weight of 362.48 g/mol. Its IUPAC name is [(2S)-1,9-dimethyl-5-(quinolin-3-ylmethyl)-2,3,4,6-tetrahydropyrido[2,3-b][1,5]diazocin-2-yl]methanol.
| Compound Name | [(2S)-1,9-dimethyl-5-(quinolin-3-ylmethyl)-2,3,4,6-tetrahydropyrido[2,3-b][1,5]diazocin-2-yl]methanol |
|---|---|
| PubChem CID | 100654194 |
| Molecular Formula | C22H26N4O |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | [(2S)-1,9-dimethyl-5-(quinolin-3-ylmethyl)-2,3,4,6-tetrahydropyrido[2,3-b][1,5]diazocin-2-yl]methanol |
| SMILES | Cc1ccc2c(n1)N(C)[C@H](CO)CCN(Cc1cnc3ccccc3c1)C2 |
| InChI | InChI=1S/C22H26N4O/c1-16-7-8-19-14-26(10-9-20(15-27)25(2)22(19)24-16)13-17-11-18-5-3-4-6-21(18)23-12-17/h3-8,11-12,20,27H,9-10,13-15H2,1-2H3/t20-/m0/s1 |
| InChIKey | UUEARFPATUKPNC-FQEVSTJZSA-N |
| XLogP | 3.14 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |