C20H27N3O — CID 100654208
5-amino-2-(4-butylanilino)-N-propan-2-ylbenzamide (PubChem CID 100654208) has the molecular formula C20H27N3O and a molecular weight of 325.46 g/mol. Its IUPAC name is 5-amino-2-(4-butylanilino)-N-propan-2-ylbenzamide.
| Compound Name | 5-amino-2-(4-butylanilino)-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 100654208 |
| Molecular Formula | C20H27N3O |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.22 |
| IUPAC Name | 5-amino-2-(4-butylanilino)-N-propan-2-ylbenzamide |
| SMILES | CCCCc1ccc(Nc2ccc(N)cc2C(=O)NC(C)C)cc1 |
| InChI | InChI=1S/C20H27N3O/c1-4-5-6-15-7-10-17(11-8-15)23-19-12-9-16(21)13-18(19)20(24)22-14(2)3/h7-14,23H,4-6,21H2,1-3H3,(H,22,24) |
| InChIKey | CFGJRSVCJSLYTK-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|