C19H23F2N3O — CID 100654384
[(2S)-5-[(3,4-difluorophenyl)methyl]-1,9-dimethyl-2,3,4,6-tetrahydropyrido[2,3-b][1,5]diazocin-2-yl]methanol (PubChem CID 100654384) has the molecular formula C19H23F2N3O and a molecular weight of 347.41 g/mol. Its IUPAC name is [(2S)-5-[(3,4-difluorophenyl)methyl]-1,9-dimethyl-2,3,4,6-tetrahydropyrido[2,3-b][1,5]diazocin-2-yl]methanol.
| Compound Name | [(2S)-5-[(3,4-difluorophenyl)methyl]-1,9-dimethyl-2,3,4,6-tetrahydropyrido[2,3-b][1,5]diazocin-2-yl]methanol |
|---|---|
| PubChem CID | 100654384 |
| Molecular Formula | C19H23F2N3O |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | [(2S)-5-[(3,4-difluorophenyl)methyl]-1,9-dimethyl-2,3,4,6-tetrahydropyrido[2,3-b][1,5]diazocin-2-yl]methanol |
| SMILES | Cc1ccc2c(n1)N(C)[C@H](CO)CCN(Cc1ccc(F)c(F)c1)C2 |
| InChI | InChI=1S/C19H23F2N3O/c1-13-3-5-15-11-24(10-14-4-6-17(20)18(21)9-14)8-7-16(12-25)23(2)19(15)22-13/h3-6,9,16,25H,7-8,10-12H2,1-2H3/t16-/m0/s1 |
| InChIKey | GIGDPUXYQBLVHL-INIZCTEOSA-N |
| XLogP | 2.87 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |