C12H17FN4O2S — CID 100655032
N-(1-cyclopropylsulfonylpiperidin-4-yl)-5-fluoropyrimidin-2-amine (PubChem CID 100655032) has the molecular formula C12H17FN4O2S and a molecular weight of 300.36 g/mol. Its IUPAC name is N-(1-cyclopropylsulfonylpiperidin-4-yl)-5-fluoropyrimidin-2-amine.
| Compound Name | N-(1-cyclopropylsulfonylpiperidin-4-yl)-5-fluoropyrimidin-2-amine |
|---|---|
| PubChem CID | 100655032 |
| Molecular Formula | C12H17FN4O2S |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | N-(1-cyclopropylsulfonylpiperidin-4-yl)-5-fluoropyrimidin-2-amine |
| SMILES | O=S(=O)(C1CC1)N1CCC(Nc2ncc(F)cn2)CC1 |
| InChI | InChI=1S/C12H17FN4O2S/c13-9-7-14-12(15-8-9)16-10-3-5-17(6-4-10)20(18,19)11-1-2-11/h7-8,10-11H,1-6H2,(H,14,15,16) |
| InChIKey | ZRCGUUWZCVMOGJ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |