C21H21NO3 — CID 10065528
9-[(3-methoxyphenyl)methyl]-5,6,7,8-tetrahydrocarbazole-1-carboxylic acid (PubChem CID 10065528) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is 9-[(3-methoxyphenyl)methyl]-5,6,7,8-tetrahydrocarbazole-1-carboxylic acid.
| Compound Name | 9-[(3-methoxyphenyl)methyl]-5,6,7,8-tetrahydrocarbazole-1-carboxylic acid |
|---|---|
| PubChem CID | 10065528 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 9-[(3-methoxyphenyl)methyl]-5,6,7,8-tetrahydrocarbazole-1-carboxylic acid |
| SMILES | COc1cccc(Cn2c3c(c4cccc(C(=O)O)c42)CCCC3)c1 |
| InChI | InChI=1S/C21H21NO3/c1-25-15-7-4-6-14(12-15)13-22-19-11-3-2-8-16(19)17-9-5-10-18(20(17)22)21(23)24/h4-7,9-10,12H,2-3,8,11,13H2,1H3,(H,23,24) |
| InChIKey | KUEGCJXOXVQDNU-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|