C13H16N6OS2 — CID 10065603
5-methylsulfanyl-8-oxo-N-prop-2-enyl-2,4,6,7,11-pentazatricyclo[7.4.0.03,7]trideca-1(9),2,4-triene-11-carbothioamide (PubChem CID 10065603) has the molecular formula C13H16N6OS2 and a molecular weight of 336.45 g/mol. Its IUPAC name is 5-methylsulfanyl-8-oxo-N-prop-2-enyl-2,4,6,7,11-pentazatricyclo[7.4.0.03,7]trideca-1(9),2,4-triene-11-carbothioamide.
| Compound Name | 5-methylsulfanyl-8-oxo-N-prop-2-enyl-2,4,6,7,11-pentazatricyclo[7.4.0.03,7]trideca-1(9),2,4-triene-11-carbothioamide |
|---|---|
| PubChem CID | 10065603 |
| Molecular Formula | C13H16N6OS2 |
| Molecular Weight | 336.45 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 5-methylsulfanyl-8-oxo-N-prop-2-enyl-2,4,6,7,11-pentazatricyclo[7.4.0.03,7]trideca-1(9),2,4-triene-11-carbothioamide |
| SMILES | C=CCNC(=S)N1CCc2nc3nc(SC)[nH]n3c(=O)c2C1 |
| InChI | InChI=1S/C13H16N6OS2/c1-3-5-14-13(21)18-6-4-9-8(7-18)10(20)19-11(15-9)16-12(17-19)22-2/h3H,1,4-7H2,2H3,(H,14,21)(H,15,16,17) |
| InChIKey | DEQHYRHEOYWUKV-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 78.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.45 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|