C31H31N3O4S — CID 100656155
(2R)-2-[[2-[N-(benzenesulfonyl)anilino]acetyl]-benzylamino]-N-methyl-3-phenylpropanamide (PubChem CID 100656155) has the molecular formula C31H31N3O4S and a molecular weight of 541.67 g/mol. Its IUPAC name is (2R)-2-[[2-[N-(benzenesulfonyl)anilino]acetyl]-benzylamino]-N-methyl-3-phenylpropanamide.
| Compound Name | (2R)-2-[[2-[N-(benzenesulfonyl)anilino]acetyl]-benzylamino]-N-methyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 100656155 |
| Molecular Formula | C31H31N3O4S |
| Molecular Weight | 541.67 g/mol |
| Exact Mass | 541.20 |
| IUPAC Name | (2R)-2-[[2-[N-(benzenesulfonyl)anilino]acetyl]-benzylamino]-N-methyl-3-phenylpropanamide |
| SMILES | CNC(=O)[C@@H](Cc1ccccc1)N(Cc1ccccc1)C(=O)CN(c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C31H31N3O4S/c1-32-31(36)29(22-25-14-6-2-7-15-25)33(23-26-16-8-3-9-17-26)30(35)24-34(27-18-10-4-11-19-27)39(37,38)28-20-12-5-13-21-28/h2-21,29H,22-24H2,1H3,(H,32,36)/t29-/m1/s1 |
| InChIKey | VMIGTVLTPJHYME-GDLZYMKVSA-N |
| XLogP | 4.27 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.67 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |