C14H19N5O3S — CID 10065659
7-amino-2-(3-cyclohexylpropyl)-6-nitro-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one (PubChem CID 10065659) has the molecular formula C14H19N5O3S and a molecular weight of 337.41 g/mol. Its IUPAC name is 7-amino-2-(3-cyclohexylpropyl)-6-nitro-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one.
| Compound Name | 7-amino-2-(3-cyclohexylpropyl)-6-nitro-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 10065659 |
| Molecular Formula | C14H19N5O3S |
| Molecular Weight | 337.41 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 7-amino-2-(3-cyclohexylpropyl)-6-nitro-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
| SMILES | Nc1nc2sc(CCCC3CCCCC3)nn2c(=O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H19N5O3S/c15-12-11(19(21)22)13(20)18-14(16-12)23-10(17-18)8-4-7-9-5-2-1-3-6-9/h9H,1-8,15H2 |
| InChIKey | OQXVFSZKFNPAKR-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 116.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.41 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|