About 1-ethyl-6-(4-propyl-1,4-diazepan-1-yl)benzo[cd]indol-2-one
1-ethyl-6-(4-propyl-1,4-diazepan-1-yl)benzo[cd]indol-2-one (PubChem CID 10065681) has the molecular formula C21H27N3O
and a molecular weight of 337.47 g/mol. Its IUPAC name is 1-ethyl-6-(4-propyl-1,4-diazepan-1-yl)benzo[cd]indol-2-one.
Molecular Properties
| Compound Name | 1-ethyl-6-(4-propyl-1,4-diazepan-1-yl)benzo[cd]indol-2-one |
| PubChem CID | 10065681 |
| Molecular Formula | C21H27N3O |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | 1-ethyl-6-(4-propyl-1,4-diazepan-1-yl)benzo[cd]indol-2-one |
| SMILES | CCCN1CCCN(c2ccc3c4c(cccc24)C(=O)N3CC)CC1 |
| InChI | InChI=1S/C21H27N3O/c1-3-11-22-12-6-13-23(15-14-22)18-9-10-19-20-16(18)7-5-8-17(20)21(25)24(19)4-2/h5,7-10H,3-4,6,11-15H2,1-2H3 |
| InChIKey | SZLGSEMGTHRWSZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-ethyl-6-(4-propyl-1,4-diazepan-1-yl)benzo[cd]indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-6-(4-propyl-1,4-diazepan-1-yl)benzo[cd]indol-2-one?
The IUPAC name of 1-ethyl-6-(4-propyl-1,4-diazepan-1-yl)benzo[cd]indol-2-one (CID 10065681) is 1-ethyl-6-(4-propyl-1,4-diazepan-1-yl)benzo[cd]indol-2-one.
What is the SMILES notation for 1-ethyl-6-(4-propyl-1,4-diazepan-1-yl)benzo[cd]indol-2-one?
The canonical SMILES for 1-ethyl-6-(4-propyl-1,4-diazepan-1-yl)benzo[cd]indol-2-one is CCCN1CCCN(c2ccc3c4c(cccc24)C(=O)N3CC)CC1.
What is the InChIKey of 1-ethyl-6-(4-propyl-1,4-diazepan-1-yl)benzo[cd]indol-2-one?
The InChIKey is SZLGSEMGTHRWSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27N3O/c1-3-11-22-12-6-13-23(15-14-22)18-9-10-19-20-16(18)7-5-8-17(20)21(25)24(19)4-2/h5,7-10H,3-4,6,11-15H2,1-2H3.
What are the key properties of 1-ethyl-6-(4-propyl-1,4-diazepan-1-yl)benzo[cd]indol-2-one?
1-ethyl-6-(4-propyl-1,4-diazepan-1-yl)benzo[cd]indol-2-one has a molecular weight of 337.47 g/mol, XLogP of 3.74, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-6-(4-propyl-1,4-diazepan-1-yl)benzo[cd]indol-2-one is sourced from PubChem (CID 10065681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).