C19H30O5 — CID 10065744
2-[(1R,2S,4aS,6S,8aS)-2-acetyl-6-(2-hydroxyacetyl)-2,6,8a-trimethyl-3,4,4a,5,7,8-hexahydro-1H-naphthalen-1-yl]acetic acid (PubChem CID 10065744) has the molecular formula C19H30O5 and a molecular weight of 338.44 g/mol. Its IUPAC name is 2-[(1R,2S,4aS,6S,8aS)-2-acetyl-6-(2-hydroxyacetyl)-2,6,8a-trimethyl-3,4,4a,5,7,8-hexahydro-1H-naphthalen-1-yl]acetic acid.
| Compound Name | 2-[(1R,2S,4aS,6S,8aS)-2-acetyl-6-(2-hydroxyacetyl)-2,6,8a-trimethyl-3,4,4a,5,7,8-hexahydro-1H-naphthalen-1-yl]acetic acid |
|---|---|
| PubChem CID | 10065744 |
| Molecular Formula | C19H30O5 |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 2-[(1R,2S,4aS,6S,8aS)-2-acetyl-6-(2-hydroxyacetyl)-2,6,8a-trimethyl-3,4,4a,5,7,8-hexahydro-1H-naphthalen-1-yl]acetic acid |
| SMILES | CC(=O)[C@@]1(C)CC[C@H]2C[C@@](C)(C(=O)CO)CC[C@]2(C)[C@H]1CC(=O)O |
| InChI | InChI=1S/C19H30O5/c1-12(21)18(3)6-5-13-10-17(2,15(22)11-20)7-8-19(13,4)14(18)9-16(23)24/h13-14,20H,5-11H2,1-4H3,(H,23,24)/t13-,14-,17-,18+,19-/m0/s1 |
| InChIKey | HSTTXHMUHOGAOL-HLQCWHFUSA-N |
| XLogP | 2.84 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |