C31H38FN3O4S — CID 100657656
(2R)-N-butyl-2-[[2-(4-ethyl-N-methylsulfonylanilino)acetyl]-[(4-fluorophenyl)methyl]amino]-3-phenylpropanamide (PubChem CID 100657656) has the molecular formula C31H38FN3O4S and a molecular weight of 567.73 g/mol. Its IUPAC name is (2R)-N-butyl-2-[[2-(4-ethyl-N-methylsulfonylanilino)acetyl]-[(4-fluorophenyl)methyl]amino]-3-phenylpropanamide.
| Compound Name | (2R)-N-butyl-2-[[2-(4-ethyl-N-methylsulfonylanilino)acetyl]-[(4-fluorophenyl)methyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100657656 |
| Molecular Formula | C31H38FN3O4S |
| Molecular Weight | 567.73 g/mol |
| Exact Mass | 567.26 |
| IUPAC Name | (2R)-N-butyl-2-[[2-(4-ethyl-N-methylsulfonylanilino)acetyl]-[(4-fluorophenyl)methyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@@H](Cc1ccccc1)N(Cc1ccc(F)cc1)C(=O)CN(c1ccc(CC)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C31H38FN3O4S/c1-4-6-20-33-31(37)29(21-25-10-8-7-9-11-25)34(22-26-12-16-27(32)17-13-26)30(36)23-35(40(3,38)39)28-18-14-24(5-2)15-19-28/h7-19,29H,4-6,20-23H2,1-3H3,(H,33,37)/t29-/m1/s1 |
| InChIKey | JTIZIOPRHUCRNY-GDLZYMKVSA-N |
| XLogP | 4.71 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.73 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|