C17H20F3NO — CID 100657709
(1'R,3S)-N-(5,5,5-trifluoropentyl)spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-carboxamide (PubChem CID 100657709) has the molecular formula C17H20F3NO and a molecular weight of 311.35 g/mol. Its IUPAC name is (1'R,3S)-N-(5,5,5-trifluoropentyl)spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-carboxamide.
| Compound Name | (1'R,3S)-N-(5,5,5-trifluoropentyl)spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-carboxamide |
|---|---|
| PubChem CID | 100657709 |
| Molecular Formula | C17H20F3NO |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | (1'R,3S)-N-(5,5,5-trifluoropentyl)spiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-carboxamide |
| SMILES | O=C(NCCCCC(F)(F)F)[C@@H]1C[C@@]12CCc1ccccc12 |
| InChI | InChI=1S/C17H20F3NO/c18-17(19,20)8-3-4-10-21-15(22)14-11-16(14)9-7-12-5-1-2-6-13(12)16/h1-2,5-6,14H,3-4,7-11H2,(H,21,22)/t14-,16+/m0/s1 |
| InChIKey | FMPQBXJYCMWBPG-GOEBONIOSA-N |
| XLogP | 3.74 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|