About 5-(4-tert-butylphenyl)-2,3-dihydroimidazo[2,1-a]isoquinoline
5-(4-tert-butylphenyl)-2,3-dihydroimidazo[2,1-a]isoquinoline (PubChem CID 10065779) has the molecular formula C21H22N2
and a molecular weight of 302.42 g/mol. Its IUPAC name is 5-(4-tert-butylphenyl)-2,3-dihydroimidazo[2,1-a]isoquinoline.
Molecular Properties
| Compound Name | 5-(4-tert-butylphenyl)-2,3-dihydroimidazo[2,1-a]isoquinoline |
| PubChem CID | 10065779 |
| Molecular Formula | C21H22N2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | 5-(4-tert-butylphenyl)-2,3-dihydroimidazo[2,1-a]isoquinoline |
| SMILES | CC(C)(C)c1ccc(C2=Cc3ccccc3C3=NCCN23)cc1 |
| InChI | InChI=1S/C21H22N2/c1-21(2,3)17-10-8-15(9-11-17)19-14-16-6-4-5-7-18(16)20-22-12-13-23(19)20/h4-11,14H,12-13H2,1-3H3 |
| InChIKey | AOAPRAZBFITKHR-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-tert-butylphenyl)-2,3-dihydroimidazo[2,1-a]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-tert-butylphenyl)-2,3-dihydroimidazo[2,1-a]isoquinoline?
The IUPAC name of 5-(4-tert-butylphenyl)-2,3-dihydroimidazo[2,1-a]isoquinoline (CID 10065779) is 5-(4-tert-butylphenyl)-2,3-dihydroimidazo[2,1-a]isoquinoline.
What is the SMILES notation for 5-(4-tert-butylphenyl)-2,3-dihydroimidazo[2,1-a]isoquinoline?
The canonical SMILES for 5-(4-tert-butylphenyl)-2,3-dihydroimidazo[2,1-a]isoquinoline is CC(C)(C)c1ccc(C2=Cc3ccccc3C3=NCCN23)cc1.
What is the InChIKey of 5-(4-tert-butylphenyl)-2,3-dihydroimidazo[2,1-a]isoquinoline?
The InChIKey is AOAPRAZBFITKHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N2/c1-21(2,3)17-10-8-15(9-11-17)19-14-16-6-4-5-7-18(16)20-22-12-13-23(19)20/h4-11,14H,12-13H2,1-3H3.
What are the key properties of 5-(4-tert-butylphenyl)-2,3-dihydroimidazo[2,1-a]isoquinoline?
5-(4-tert-butylphenyl)-2,3-dihydroimidazo[2,1-a]isoquinoline has a molecular weight of 302.42 g/mol, XLogP of 4.56, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-tert-butylphenyl)-2,3-dihydroimidazo[2,1-a]isoquinoline is sourced from PubChem (CID 10065779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).