C21H27N3O5S — CID 100658157
furan-3-yl-[4-[3-(4-hydroxypiperidin-1-yl)sulfonylanilino]piperidin-1-yl]methanone (PubChem CID 100658157) has the molecular formula C21H27N3O5S and a molecular weight of 433.53 g/mol. Its IUPAC name is furan-3-yl-[4-[3-(4-hydroxypiperidin-1-yl)sulfonylanilino]piperidin-1-yl]methanone.
| Compound Name | furan-3-yl-[4-[3-(4-hydroxypiperidin-1-yl)sulfonylanilino]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 100658157 |
| Molecular Formula | C21H27N3O5S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | furan-3-yl-[4-[3-(4-hydroxypiperidin-1-yl)sulfonylanilino]piperidin-1-yl]methanone |
| SMILES | O=C(c1ccoc1)N1CCC(Nc2cccc(S(=O)(=O)N3CCC(O)CC3)c2)CC1 |
| InChI | InChI=1S/C21H27N3O5S/c25-19-6-11-24(12-7-19)30(27,28)20-3-1-2-18(14-20)22-17-4-9-23(10-5-17)21(26)16-8-13-29-15-16/h1-3,8,13-15,17,19,22,25H,4-7,9-12H2 |
| InChIKey | ADQRVGHRYNZRAA-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 103.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |