C21H34N2O6 — CID 100658635
tert-butyl (3aS,6aS)-3a-(4-ethoxycarbonyl-4-hydroxypiperidine-1-carbonyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate (PubChem CID 100658635) has the molecular formula C21H34N2O6 and a molecular weight of 410.51 g/mol. Its IUPAC name is tert-butyl (3aS,6aS)-3a-(4-ethoxycarbonyl-4-hydroxypiperidine-1-carbonyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate.
| Compound Name | tert-butyl (3aS,6aS)-3a-(4-ethoxycarbonyl-4-hydroxypiperidine-1-carbonyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 100658635 |
| Molecular Formula | C21H34N2O6 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | tert-butyl (3aS,6aS)-3a-(4-ethoxycarbonyl-4-hydroxypiperidine-1-carbonyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate |
| SMILES | CCOC(=O)C1(O)CCN(C(=O)[C@@]23CCC[C@@H]2CN(C(=O)OC(C)(C)C)C3)CC1 |
| InChI | InChI=1S/C21H34N2O6/c1-5-28-17(25)21(27)9-11-22(12-10-21)16(24)20-8-6-7-15(20)13-23(14-20)18(26)29-19(2,3)4/h15,27H,5-14H2,1-4H3/t15-,20-/m1/s1 |
| InChIKey | LQEUDBYRXVUISR-FOIQADDNSA-N |
| XLogP | 1.94 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |