C20H36O4 — CID 10065864
2-[(3R,4R,6R)-4,6-diethyl-6-[(E)-4-ethyloct-1-enyl]dioxan-3-yl]acetic acid (PubChem CID 10065864) has the molecular formula C20H36O4 and a molecular weight of 340.50 g/mol. Its IUPAC name is 2-[(3R,4R,6R)-4,6-diethyl-6-[(E)-4-ethyloct-1-enyl]dioxan-3-yl]acetic acid.
| Compound Name | 2-[(3R,4R,6R)-4,6-diethyl-6-[(E)-4-ethyloct-1-enyl]dioxan-3-yl]acetic acid |
|---|---|
| PubChem CID | 10065864 |
| Molecular Formula | C20H36O4 |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | 2-[(3R,4R,6R)-4,6-diethyl-6-[(E)-4-ethyloct-1-enyl]dioxan-3-yl]acetic acid |
| SMILES | CCCCC(CC)C/C=C/[C@@]1(CC)C[C@@H](CC)[C@@H](CC(=O)O)OO1 |
| InChI | InChI=1S/C20H36O4/c1-5-9-11-16(6-2)12-10-13-20(8-4)15-17(7-3)18(23-24-20)14-19(21)22/h10,13,16-18H,5-9,11-12,14-15H2,1-4H3,(H,21,22)/b13-10+/t16?,17-,18-,20+/m1/s1 |
| InChIKey | GINQGMVTUCFNJP-MUGWROLBSA-N |
| XLogP | 5.52 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|