About 4-[5-(5,8-dimethylnaphthalen-2-yl)-1H-pyrrol-2-yl]benzoic acid
4-[5-(5,8-dimethylnaphthalen-2-yl)-1H-pyrrol-2-yl]benzoic acid (PubChem CID 10065907) has the molecular formula C23H19NO2
and a molecular weight of 341.41 g/mol. Its IUPAC name is 4-[5-(5,8-dimethylnaphthalen-2-yl)-1H-pyrrol-2-yl]benzoic acid.
Molecular Properties
| Compound Name | 4-[5-(5,8-dimethylnaphthalen-2-yl)-1H-pyrrol-2-yl]benzoic acid |
| PubChem CID | 10065907 |
| Molecular Formula | C23H19NO2 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 4-[5-(5,8-dimethylnaphthalen-2-yl)-1H-pyrrol-2-yl]benzoic acid |
| SMILES | Cc1ccc(C)c2cc(-c3ccc(-c4ccc(C(=O)O)cc4)[nH]3)ccc12 |
| InChI | InChI=1S/C23H19NO2/c1-14-3-4-15(2)20-13-18(9-10-19(14)20)22-12-11-21(24-22)16-5-7-17(8-6-16)23(25)26/h3-13,24H,1-2H3,(H,25,26) |
| InChIKey | NMDQLQUCDVIJQE-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-[5-(5,8-dimethylnaphthalen-2-yl)-1H-pyrrol-2-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(5,8-dimethylnaphthalen-2-yl)-1H-pyrrol-2-yl]benzoic acid?
The IUPAC name of 4-[5-(5,8-dimethylnaphthalen-2-yl)-1H-pyrrol-2-yl]benzoic acid (CID 10065907) is 4-[5-(5,8-dimethylnaphthalen-2-yl)-1H-pyrrol-2-yl]benzoic acid.
What is the SMILES notation for 4-[5-(5,8-dimethylnaphthalen-2-yl)-1H-pyrrol-2-yl]benzoic acid?
The canonical SMILES for 4-[5-(5,8-dimethylnaphthalen-2-yl)-1H-pyrrol-2-yl]benzoic acid is Cc1ccc(C)c2cc(-c3ccc(-c4ccc(C(=O)O)cc4)[nH]3)ccc12.
What is the InChIKey of 4-[5-(5,8-dimethylnaphthalen-2-yl)-1H-pyrrol-2-yl]benzoic acid?
The InChIKey is NMDQLQUCDVIJQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19NO2/c1-14-3-4-15(2)20-13-18(9-10-19(14)20)22-12-11-21(24-22)16-5-7-17(8-6-16)23(25)26/h3-13,24H,1-2H3,(H,25,26).
What are the key properties of 4-[5-(5,8-dimethylnaphthalen-2-yl)-1H-pyrrol-2-yl]benzoic acid?
4-[5-(5,8-dimethylnaphthalen-2-yl)-1H-pyrrol-2-yl]benzoic acid has a molecular weight of 341.41 g/mol, XLogP of 5.82, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(5,8-dimethylnaphthalen-2-yl)-1H-pyrrol-2-yl]benzoic acid is sourced from PubChem (CID 10065907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).