C17H14BrFN4O4 — CID 100659239
5-bromo-N-[(3S)-1-(2-fluorophenyl)-2-oxopiperidin-3-yl]-2-nitropyridine-4-carboxamide (PubChem CID 100659239) has the molecular formula C17H14BrFN4O4 and a molecular weight of 437.23 g/mol. Its IUPAC name is 5-bromo-N-[(3S)-1-(2-fluorophenyl)-2-oxopiperidin-3-yl]-2-nitropyridine-4-carboxamide.
| Compound Name | 5-bromo-N-[(3S)-1-(2-fluorophenyl)-2-oxopiperidin-3-yl]-2-nitropyridine-4-carboxamide |
|---|---|
| PubChem CID | 100659239 |
| Molecular Formula | C17H14BrFN4O4 |
| Molecular Weight | 437.23 g/mol |
| Exact Mass | 436.02 |
| IUPAC Name | 5-bromo-N-[(3S)-1-(2-fluorophenyl)-2-oxopiperidin-3-yl]-2-nitropyridine-4-carboxamide |
| SMILES | O=C(N[C@H]1CCCN(c2ccccc2F)C1=O)c1cc([N+](=O)[O-])ncc1Br |
| InChI | InChI=1S/C17H14BrFN4O4/c18-11-9-20-15(23(26)27)8-10(11)16(24)21-13-5-3-7-22(17(13)25)14-6-2-1-4-12(14)19/h1-2,4,6,8-9,13H,3,5,7H2,(H,21,24)/t13-/m0/s1 |
| InChIKey | VBWUILRVYLJNEX-ZDUSSCGKSA-N |
| XLogP | 2.82 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.23 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|