C16H20N4O2 — CID 100659561
(3S)-4-cyclopentyl-3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)morpholine (PubChem CID 100659561) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is (3S)-4-cyclopentyl-3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)morpholine.
| Compound Name | (3S)-4-cyclopentyl-3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)morpholine |
|---|---|
| PubChem CID | 100659561 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | (3S)-4-cyclopentyl-3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)morpholine |
| SMILES | c1cncc(-c2noc([C@@H]3COCCN3C3CCCC3)n2)c1 |
| InChI | InChI=1S/C16H20N4O2/c1-2-6-13(5-1)20-8-9-21-11-14(20)16-18-15(19-22-16)12-4-3-7-17-10-12/h3-4,7,10,13-14H,1-2,5-6,8-9,11H2/t14-/m0/s1 |
| InChIKey | ZPLLXXDLEFOGRR-AWEZNQCLSA-N |
| XLogP | 2.45 |
| TPSA | 64.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |