C20H27N3O — CID 100659586
1-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-(5,6-dimethylbenzimidazol-1-yl)ethanone (PubChem CID 100659586) has the molecular formula C20H27N3O and a molecular weight of 325.46 g/mol. Its IUPAC name is 1-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-(5,6-dimethylbenzimidazol-1-yl)ethanone.
| Compound Name | 1-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-(5,6-dimethylbenzimidazol-1-yl)ethanone |
|---|---|
| PubChem CID | 100659586 |
| Molecular Formula | C20H27N3O |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.22 |
| IUPAC Name | 1-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-(5,6-dimethylbenzimidazol-1-yl)ethanone |
| SMILES | Cc1cc2ncn(CC(=O)N3CCC[C@@H]4CCCC[C@H]43)c2cc1C |
| InChI | InChI=1S/C20H27N3O/c1-14-10-17-19(11-15(14)2)22(13-21-17)12-20(24)23-9-5-7-16-6-3-4-8-18(16)23/h10-11,13,16,18H,3-9,12H2,1-2H3/t16-,18+/m0/s1 |
| InChIKey | YLBGPFDEBUKVPX-FUHWJXTLSA-N |
| XLogP | 3.83 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |