C13H15F5NO2P — CID 10066014
1-[ethoxy(methyl)phosphoryl]-2,2,3,3,3-pentafluoro-N-(4-methylphenyl)propan-1-imine (PubChem CID 10066014) has the molecular formula C13H15F5NO2P and a molecular weight of 343.23 g/mol. Its IUPAC name is 1-[ethoxy(methyl)phosphoryl]-2,2,3,3,3-pentafluoro-N-(4-methylphenyl)propan-1-imine.
| Compound Name | 1-[ethoxy(methyl)phosphoryl]-2,2,3,3,3-pentafluoro-N-(4-methylphenyl)propan-1-imine |
|---|---|
| PubChem CID | 10066014 |
| Molecular Formula | C13H15F5NO2P |
| Molecular Weight | 343.23 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | 1-[ethoxy(methyl)phosphoryl]-2,2,3,3,3-pentafluoro-N-(4-methylphenyl)propan-1-imine |
| SMILES | CCOP(C)(=O)/C(=N\c1ccc(C)cc1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H15F5NO2P/c1-4-21-22(3,20)11(12(14,15)13(16,17)18)19-10-7-5-9(2)6-8-10/h5-8H,4H2,1-3H3/b19-11- |
| InChIKey | DETHOWMYOQICNW-ODLFYWEKSA-N |
| XLogP | 5.17 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.23 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|