C23H30N2O5S — CID 100660703
(3S)-1-(benzenesulfonyl)-N-[(3,4-diethoxyphenyl)methyl]piperidine-3-carboxamide (PubChem CID 100660703) has the molecular formula C23H30N2O5S and a molecular weight of 446.57 g/mol. Its IUPAC name is (3S)-1-(benzenesulfonyl)-N-[(3,4-diethoxyphenyl)methyl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-(benzenesulfonyl)-N-[(3,4-diethoxyphenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 100660703 |
| Molecular Formula | C23H30N2O5S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | (3S)-1-(benzenesulfonyl)-N-[(3,4-diethoxyphenyl)methyl]piperidine-3-carboxamide |
| SMILES | CCOc1ccc(CNC(=O)[C@H]2CCCN(S(=O)(=O)c3ccccc3)C2)cc1OCC |
| InChI | InChI=1S/C23H30N2O5S/c1-3-29-21-13-12-18(15-22(21)30-4-2)16-24-23(26)19-9-8-14-25(17-19)31(27,28)20-10-6-5-7-11-20/h5-7,10-13,15,19H,3-4,8-9,14,16-17H2,1-2H3,(H,24,26)/t19-/m0/s1 |
| InChIKey | JYKCQGRZUXETER-IBGZPJMESA-N |
| XLogP | 3.20 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |