C26H22FN5OS — CID 100661046
2-[(4R,5S)-5-[1-(3-fluorophenyl)pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-phenylacetamide (PubChem CID 100661046) has the molecular formula C26H22FN5OS and a molecular weight of 471.56 g/mol. Its IUPAC name is 2-[(4R,5S)-5-[1-(3-fluorophenyl)pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-phenylacetamide.
| Compound Name | 2-[(4R,5S)-5-[1-(3-fluorophenyl)pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 100661046 |
| Molecular Formula | C26H22FN5OS |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | 2-[(4R,5S)-5-[1-(3-fluorophenyl)pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-phenylacetamide |
| SMILES | O=C(CN1C(=S)N[C@@H](c2ccccn2)[C@H]1c1cccn1-c1cccc(F)c1)Nc1ccccc1 |
| InChI | InChI=1S/C26H22FN5OS/c27-18-8-6-11-20(16-18)31-15-7-13-22(31)25-24(21-12-4-5-14-28-21)30-26(34)32(25)17-23(33)29-19-9-2-1-3-10-19/h1-16,24-25H,17H2,(H,29,33)(H,30,34)/t24-,25+/m0/s1 |
| InChIKey | BNVKDBVUHYTYBM-LOSJGSFVSA-N |
| XLogP | 4.62 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|