C20H30OSSi — CID 10066237
tert-butyl-dimethyl-[(1R,2R)-2-methyl-5-phenylsulfanylcyclohepta-3,5-dien-1-yl]oxysilane (PubChem CID 10066237) has the molecular formula C20H30OSSi and a molecular weight of 346.61 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1R,2R)-2-methyl-5-phenylsulfanylcyclohepta-3,5-dien-1-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(1R,2R)-2-methyl-5-phenylsulfanylcyclohepta-3,5-dien-1-yl]oxysilane |
|---|---|
| PubChem CID | 10066237 |
| Molecular Formula | C20H30OSSi |
| Molecular Weight | 346.61 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | tert-butyl-dimethyl-[(1R,2R)-2-methyl-5-phenylsulfanylcyclohepta-3,5-dien-1-yl]oxysilane |
| SMILES | C[C@@H]1C=CC(Sc2ccccc2)=CC[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H30OSSi/c1-16-12-13-18(22-17-10-8-7-9-11-17)14-15-19(16)21-23(5,6)20(2,3)4/h7-14,16,19H,15H2,1-6H3/t16-,19-/m1/s1 |
| InChIKey | LMMKTANNWWHPDQ-VQIMIIECSA-N |
| XLogP | 6.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.61 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|