C18H26FN3O5 — CID 100662698
2-[(2S,3aR,5R,6R,6aR)-5-[[(3-fluoro-4-pyridinyl)methylamino]methyl]-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 100662698) has the molecular formula C18H26FN3O5 and a molecular weight of 383.42 g/mol. Its IUPAC name is 2-[(2S,3aR,5R,6R,6aR)-5-[[(3-fluoro-4-pyridinyl)methylamino]methyl]-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[(2S,3aR,5R,6R,6aR)-5-[[(3-fluoro-4-pyridinyl)methylamino]methyl]-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 100662698 |
| Molecular Formula | C18H26FN3O5 |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | 2-[(2S,3aR,5R,6R,6aR)-5-[[(3-fluoro-4-pyridinyl)methylamino]methyl]-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)C[C@@H]1C[C@H]2O[C@H](CNCc3ccncc3F)[C@@H](O)[C@H]2O1 |
| InChI | InChI=1S/C18H26FN3O5/c1-25-5-4-22-16(23)7-12-6-14-18(26-12)17(24)15(27-14)10-21-8-11-2-3-20-9-13(11)19/h2-3,9,12,14-15,17-18,21,24H,4-8,10H2,1H3,(H,22,23)/t12-,14+,15+,17+,18-/m0/s1 |
| InChIKey | WIYOYXXQUJBHNW-UUWMRLDISA-N |
| XLogP | -0.25 |
| TPSA | 101.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|