C14H25NO2 — CID 100663043
[(3R)-3-[[(1S,6S)-2,6-dimethylcyclohex-2-en-1-yl]methylamino]oxolan-3-yl]methanol (PubChem CID 100663043) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is [(3R)-3-[[(1S,6S)-2,6-dimethylcyclohex-2-en-1-yl]methylamino]oxolan-3-yl]methanol.
| Compound Name | [(3R)-3-[[(1S,6S)-2,6-dimethylcyclohex-2-en-1-yl]methylamino]oxolan-3-yl]methanol |
|---|---|
| PubChem CID | 100663043 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | [(3R)-3-[[(1S,6S)-2,6-dimethylcyclohex-2-en-1-yl]methylamino]oxolan-3-yl]methanol |
| SMILES | CC1=CCC[C@H](C)[C@@H]1CN[C@@]1(CO)CCOC1 |
| InChI | InChI=1S/C14H25NO2/c1-11-4-3-5-12(2)13(11)8-15-14(9-16)6-7-17-10-14/h4,12-13,15-16H,3,5-10H2,1-2H3/t12-,13+,14+/m0/s1 |
| InChIKey | OEKJLNAVXDTSLS-BFHYXJOUSA-N |
| XLogP | 1.72 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|