About [1-[(3R,4S)-4-methoxyoxolan-3-yl]triazol-4-yl]methanamine
[1-[(3R,4S)-4-methoxyoxolan-3-yl]triazol-4-yl]methanamine (PubChem CID 100664503) has the molecular formula C8H14N4O2
and a molecular weight of 198.23 g/mol. Its IUPAC name is [1-[(3R,4S)-4-methoxyoxolan-3-yl]triazol-4-yl]methanamine.
Molecular Properties
| Compound Name | [1-[(3R,4S)-4-methoxyoxolan-3-yl]triazol-4-yl]methanamine |
| PubChem CID | 100664503 |
| Molecular Formula | C8H14N4O2 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | [1-[(3R,4S)-4-methoxyoxolan-3-yl]triazol-4-yl]methanamine |
| SMILES | CO[C@@H]1COC[C@H]1n1cc(CN)nn1 |
| InChI | InChI=1S/C8H14N4O2/c1-13-8-5-14-4-7(8)12-3-6(2-9)10-11-12/h3,7-8H,2,4-5,9H2,1H3/t7-,8-/m1/s1 |
| InChIKey | DIFOQOVHIIKTLT-HTQZYQBOSA-N |
| XLogP | -0.68 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [1-[(3R,4S)-4-methoxyoxolan-3-yl]triazol-4-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(3R,4S)-4-methoxyoxolan-3-yl]triazol-4-yl]methanamine?
The IUPAC name of [1-[(3R,4S)-4-methoxyoxolan-3-yl]triazol-4-yl]methanamine (CID 100664503) is [1-[(3R,4S)-4-methoxyoxolan-3-yl]triazol-4-yl]methanamine.
What is the SMILES notation for [1-[(3R,4S)-4-methoxyoxolan-3-yl]triazol-4-yl]methanamine?
The canonical SMILES for [1-[(3R,4S)-4-methoxyoxolan-3-yl]triazol-4-yl]methanamine is CO[C@@H]1COC[C@H]1n1cc(CN)nn1.
What is the InChIKey of [1-[(3R,4S)-4-methoxyoxolan-3-yl]triazol-4-yl]methanamine?
The InChIKey is DIFOQOVHIIKTLT-HTQZYQBOSA-N. The full InChI is InChI=1S/C8H14N4O2/c1-13-8-5-14-4-7(8)12-3-6(2-9)10-11-12/h3,7-8H,2,4-5,9H2,1H3/t7-,8-/m1/s1.
What are the key properties of [1-[(3R,4S)-4-methoxyoxolan-3-yl]triazol-4-yl]methanamine?
[1-[(3R,4S)-4-methoxyoxolan-3-yl]triazol-4-yl]methanamine has a molecular weight of 198.23 g/mol, XLogP of -0.68, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(3R,4S)-4-methoxyoxolan-3-yl]triazol-4-yl]methanamine is sourced from PubChem (CID 100664503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).