About (3S)-1'-(4-ethylsulfonylphenyl)spiro[1H-2-benzofuran-3,3'-pyrrolidine]
(3S)-1'-(4-ethylsulfonylphenyl)spiro[1H-2-benzofuran-3,3'-pyrrolidine] (PubChem CID 100665673) has the molecular formula C19H21NO3S
and a molecular weight of 343.45 g/mol. Its IUPAC name is (3S)-1'-(4-ethylsulfonylphenyl)spiro[1H-2-benzofuran-3,3'-pyrrolidine].
Molecular Properties
| Compound Name | (3S)-1'-(4-ethylsulfonylphenyl)spiro[1H-2-benzofuran-3,3'-pyrrolidine] |
| PubChem CID | 100665673 |
| Molecular Formula | C19H21NO3S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | (3S)-1'-(4-ethylsulfonylphenyl)spiro[1H-2-benzofuran-3,3'-pyrrolidine] |
| SMILES | CCS(=O)(=O)c1ccc(N2CC[C@]3(C2)OCc2ccccc23)cc1 |
| InChI | InChI=1S/C19H21NO3S/c1-2-24(21,22)17-9-7-16(8-10-17)20-12-11-19(14-20)18-6-4-3-5-15(18)13-23-19/h3-10H,2,11-14H2,1H3/t19-/m1/s1 |
| InChIKey | ZBBYHWOFSBOQCM-LJQANCHMSA-N |
| XLogP | 3.12 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3S)-1'-(4-ethylsulfonylphenyl)spiro[1H-2-benzofuran-3,3'-pyrrolidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1'-(4-ethylsulfonylphenyl)spiro[1H-2-benzofuran-3,3'-pyrrolidine]?
The IUPAC name of (3S)-1'-(4-ethylsulfonylphenyl)spiro[1H-2-benzofuran-3,3'-pyrrolidine] (CID 100665673) is (3S)-1'-(4-ethylsulfonylphenyl)spiro[1H-2-benzofuran-3,3'-pyrrolidine].
What is the SMILES notation for (3S)-1'-(4-ethylsulfonylphenyl)spiro[1H-2-benzofuran-3,3'-pyrrolidine]?
The canonical SMILES for (3S)-1'-(4-ethylsulfonylphenyl)spiro[1H-2-benzofuran-3,3'-pyrrolidine] is CCS(=O)(=O)c1ccc(N2CC[C@]3(C2)OCc2ccccc23)cc1.
What is the InChIKey of (3S)-1'-(4-ethylsulfonylphenyl)spiro[1H-2-benzofuran-3,3'-pyrrolidine]?
The InChIKey is ZBBYHWOFSBOQCM-LJQANCHMSA-N. The full InChI is InChI=1S/C19H21NO3S/c1-2-24(21,22)17-9-7-16(8-10-17)20-12-11-19(14-20)18-6-4-3-5-15(18)13-23-19/h3-10H,2,11-14H2,1H3/t19-/m1/s1.
What are the key properties of (3S)-1'-(4-ethylsulfonylphenyl)spiro[1H-2-benzofuran-3,3'-pyrrolidine]?
(3S)-1'-(4-ethylsulfonylphenyl)spiro[1H-2-benzofuran-3,3'-pyrrolidine] has a molecular weight of 343.45 g/mol, XLogP of 3.12, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1'-(4-ethylsulfonylphenyl)spiro[1H-2-benzofuran-3,3'-pyrrolidine] is sourced from PubChem (CID 100665673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).