C14H13BrN2O4 — CID 10066635
methyl 2-(7-bromo-2,3-dioxo-1,4-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-12-yl)acetate (PubChem CID 10066635) has the molecular formula C14H13BrN2O4 and a molecular weight of 353.17 g/mol. Its IUPAC name is methyl 2-(7-bromo-2,3-dioxo-1,4-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-12-yl)acetate.
| Compound Name | methyl 2-(7-bromo-2,3-dioxo-1,4-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-12-yl)acetate |
|---|---|
| PubChem CID | 10066635 |
| Molecular Formula | C14H13BrN2O4 |
| Molecular Weight | 353.17 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | methyl 2-(7-bromo-2,3-dioxo-1,4-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-12-yl)acetate |
| SMILES | COC(=O)CC1CCc2cc(Br)cc3[nH]c(=O)c(=O)n1c23 |
| InChI | InChI=1S/C14H13BrN2O4/c1-21-11(18)6-9-3-2-7-4-8(15)5-10-12(7)17(9)14(20)13(19)16-10/h4-5,9H,2-3,6H2,1H3,(H,16,19) |
| InChIKey | DJBJHCWNSQGQQA-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.17 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|