C17H15ClF3N3 — CID 10066676
6-chloro-5-phenyl-N-(4,4,4-trifluorobutyl)-1H-indazol-3-amine (PubChem CID 10066676) has the molecular formula C17H15ClF3N3 and a molecular weight of 353.78 g/mol. Its IUPAC name is 6-chloro-5-phenyl-N-(4,4,4-trifluorobutyl)-1H-indazol-3-amine.
| Compound Name | 6-chloro-5-phenyl-N-(4,4,4-trifluorobutyl)-1H-indazol-3-amine |
|---|---|
| PubChem CID | 10066676 |
| Molecular Formula | C17H15ClF3N3 |
| Molecular Weight | 353.78 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 6-chloro-5-phenyl-N-(4,4,4-trifluorobutyl)-1H-indazol-3-amine |
| SMILES | FC(F)(F)CCCNc1n[nH]c2cc(Cl)c(-c3ccccc3)cc12 |
| InChI | InChI=1S/C17H15ClF3N3/c18-14-10-15-13(9-12(14)11-5-2-1-3-6-11)16(24-23-15)22-8-4-7-17(19,20)21/h1-3,5-6,9-10H,4,7-8H2,(H2,22,23,24) |
| InChIKey | DGBACHDOZOUUOF-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.78 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|