C19H19FN4O2 — CID 10066703
3-(4-ethoxyphenyl)-1-(3-fluoro-4-pyrimidin-2-ylpiperazin-1-yl)prop-2-yn-1-one (PubChem CID 10066703) has the molecular formula C19H19FN4O2 and a molecular weight of 354.39 g/mol. Its IUPAC name is 3-(4-ethoxyphenyl)-1-(3-fluoro-4-pyrimidin-2-ylpiperazin-1-yl)prop-2-yn-1-one.
| Compound Name | 3-(4-ethoxyphenyl)-1-(3-fluoro-4-pyrimidin-2-ylpiperazin-1-yl)prop-2-yn-1-one |
|---|---|
| PubChem CID | 10066703 |
| Molecular Formula | C19H19FN4O2 |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 3-(4-ethoxyphenyl)-1-(3-fluoro-4-pyrimidin-2-ylpiperazin-1-yl)prop-2-yn-1-one |
| SMILES | CCOc1ccc(C#CC(=O)N2CCN(c3ncccn3)C(F)C2)cc1 |
| InChI | InChI=1S/C19H19FN4O2/c1-2-26-16-7-4-15(5-8-16)6-9-18(25)23-12-13-24(17(20)14-23)19-21-10-3-11-22-19/h3-5,7-8,10-11,17H,2,12-14H2,1H3 |
| InChIKey | GCUKZCRRSUGUTI-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|