C17H22O6S — CID 10066715
diethyl 2-[(E)-2-(benzenesulfonyl)but-2-enyl]propanedioate (PubChem CID 10066715) has the molecular formula C17H22O6S and a molecular weight of 354.42 g/mol. Its IUPAC name is diethyl 2-[(E)-2-(benzenesulfonyl)but-2-enyl]propanedioate.
| Compound Name | diethyl 2-[(E)-2-(benzenesulfonyl)but-2-enyl]propanedioate |
|---|---|
| PubChem CID | 10066715 |
| Molecular Formula | C17H22O6S |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | diethyl 2-[(E)-2-(benzenesulfonyl)but-2-enyl]propanedioate |
| SMILES | C/C=C(\CC(C(=O)OCC)C(=O)OCC)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H22O6S/c1-4-13(24(20,21)14-10-8-7-9-11-14)12-15(16(18)22-5-2)17(19)23-6-3/h4,7-11,15H,5-6,12H2,1-3H3/b13-4+ |
| InChIKey | CKVOMIGHJJNSCM-YIXHJXPBSA-N |
| XLogP | 2.50 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|