About (6-bromo-2,3-dihydro-1,4-benzoxazin-4-yl)-(1-phenylpyrazol-3-yl)methanone
(6-bromo-2,3-dihydro-1,4-benzoxazin-4-yl)-(1-phenylpyrazol-3-yl)methanone (PubChem CID 100668081) has the molecular formula C18H14BrN3O2
and a molecular weight of 384.23 g/mol. Its IUPAC name is (6-bromo-2,3-dihydro-1,4-benzoxazin-4-yl)-(1-phenylpyrazol-3-yl)methanone.
Molecular Properties
| Compound Name | (6-bromo-2,3-dihydro-1,4-benzoxazin-4-yl)-(1-phenylpyrazol-3-yl)methanone |
| PubChem CID | 100668081 |
| Molecular Formula | C18H14BrN3O2 |
| Molecular Weight | 384.23 g/mol |
| Exact Mass | 383.03 |
| IUPAC Name | (6-bromo-2,3-dihydro-1,4-benzoxazin-4-yl)-(1-phenylpyrazol-3-yl)methanone |
| SMILES | O=C(c1ccn(-c2ccccc2)n1)N1CCOc2ccc(Br)cc21 |
| InChI | InChI=1S/C18H14BrN3O2/c19-13-6-7-17-16(12-13)21(10-11-24-17)18(23)15-8-9-22(20-15)14-4-2-1-3-5-14/h1-9,12H,10-11H2 |
| InChIKey | IUOMURJTPXKOQB-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.23 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6-bromo-2,3-dihydro-1,4-benzoxazin-4-yl)-(1-phenylpyrazol-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-bromo-2,3-dihydro-1,4-benzoxazin-4-yl)-(1-phenylpyrazol-3-yl)methanone?
The IUPAC name of (6-bromo-2,3-dihydro-1,4-benzoxazin-4-yl)-(1-phenylpyrazol-3-yl)methanone (CID 100668081) is (6-bromo-2,3-dihydro-1,4-benzoxazin-4-yl)-(1-phenylpyrazol-3-yl)methanone.
What is the SMILES notation for (6-bromo-2,3-dihydro-1,4-benzoxazin-4-yl)-(1-phenylpyrazol-3-yl)methanone?
The canonical SMILES for (6-bromo-2,3-dihydro-1,4-benzoxazin-4-yl)-(1-phenylpyrazol-3-yl)methanone is O=C(c1ccn(-c2ccccc2)n1)N1CCOc2ccc(Br)cc21.
What is the InChIKey of (6-bromo-2,3-dihydro-1,4-benzoxazin-4-yl)-(1-phenylpyrazol-3-yl)methanone?
The InChIKey is IUOMURJTPXKOQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14BrN3O2/c19-13-6-7-17-16(12-13)21(10-11-24-17)18(23)15-8-9-22(20-15)14-4-2-1-3-5-14/h1-9,12H,10-11H2.
What are the key properties of (6-bromo-2,3-dihydro-1,4-benzoxazin-4-yl)-(1-phenylpyrazol-3-yl)methanone?
(6-bromo-2,3-dihydro-1,4-benzoxazin-4-yl)-(1-phenylpyrazol-3-yl)methanone has a molecular weight of 384.23 g/mol, XLogP of 3.67, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-bromo-2,3-dihydro-1,4-benzoxazin-4-yl)-(1-phenylpyrazol-3-yl)methanone is sourced from PubChem (CID 100668081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).