C20H20O4S — CID 10066859
(1S,2S,4R,7S,9S,12R)-4,12-diphenyl-3,5,11,13-tetraoxa-8-thiatricyclo[7.4.0.02,7]tridecane (PubChem CID 10066859) has the molecular formula C20H20O4S and a molecular weight of 356.44 g/mol. Its IUPAC name is (1S,2S,4R,7S,9S,12R)-4,12-diphenyl-3,5,11,13-tetraoxa-8-thiatricyclo[7.4.0.02,7]tridecane.
| Compound Name | (1S,2S,4R,7S,9S,12R)-4,12-diphenyl-3,5,11,13-tetraoxa-8-thiatricyclo[7.4.0.02,7]tridecane |
|---|---|
| PubChem CID | 10066859 |
| Molecular Formula | C20H20O4S |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | (1S,2S,4R,7S,9S,12R)-4,12-diphenyl-3,5,11,13-tetraoxa-8-thiatricyclo[7.4.0.02,7]tridecane |
| SMILES | c1ccc([C@@H]2OC[C@@H]3S[C@H]4CO[C@@H](c5ccccc5)O[C@H]4[C@@H]3O2)cc1 |
| InChI | InChI=1S/C20H20O4S/c1-3-7-13(8-4-1)19-21-11-15-17(23-19)18-16(25-15)12-22-20(24-18)14-9-5-2-6-10-14/h1-10,15-20H,11-12H2/t15-,16-,17+,18+,19+,20+/m0/s1 |
| InChIKey | AZZHLSVJBCNNCA-VTYCOLDWSA-N |
| XLogP | 3.70 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |